![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| BOPC-409 Lab in Plant Molecular Biology and Genetic Engineering.pdf | 2024-04-08 12:05 | 286K | |
| BOTE-404 Mycorrhizal Biotechnology.pdf | 2024-04-08 12:05 | 286K | |
| BOPE-404 Lab in Mycorrhizal Biotechnology.pdf | 2024-04-08 12:05 | 287K | |
| BOPC-405 Lab in Microbiology and Plant Pathology.pdf | 2024-04-08 12:05 | 288K | |
| BOPC-406 Lab in Cytogenetics and Plant Breeding.pdf | 2024-04-08 12:05 | 288K | |
| BOTC-406 Cytogenetics and Plant Breeding.pdf | 2024-04-08 12:05 | 288K | |
| BOTC-405 Microbiology and Plant Pathology.pdf | 2024-04-08 12:05 | 291K | |
| BOTE-405 Introduction to Paleoflora.pdf | 2024-04-08 12:05 | 292K | |
| BOTC-407 Plant Molecular Biology.pdf | 2024-04-08 12:05 | 292K | |
| BOTC-408 Plant Genetic Engineering.pdf | 2024-04-08 12:05 | 304K | |