![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| ZOO-328 Fish Processing.pdf | 2024-04-08 12:05 | 286K | |
| ZOO-336 Wildlife Conservation.pdf | 2024-04-08 12:05 | 293K | |
| BOC-422 Lab in Cytogenetics and Plant Breeding.pdf | 2024-04-08 12:05 | 298K | |
| BOC-321 Plant Molecular Biology.pdf | 2024-04-08 12:05 | 299K | |
| BOC-421 Cytogenetics and Plant Breeding.pdf | 2024-04-08 12:05 | 301K | |
| BOC-324 Lab in Plant Molecular Biology and Genetic Engineering.pdf | 2024-04-08 12:05 | 309K | |
| BOC-323 Plant Genetic Engineering.pdf | 2024-04-08 12:05 | 317K | |