![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | BCO 501 Hormones.pdf | 2024-04-08 12:05 | 280K | |
| ICO-502 Catalysis - The basic Chemical concepts.pdf | 2024-04-08 12:05 | 291K | |
| BCO 508 Nanobiotechnology.pdf | 2024-04-08 12:05 | 292K | |
| BCO 505 Drug metabolism and Pharmaceutics.pdf | 2024-04-08 12:05 | 292K | |
| BCD 510 Dissertation.pdf | 2024-04-08 12:05 | 292K | |
| PCO-502 Catalysis - Fundamentals and Applications.pdf | 2024-04-08 12:05 | 292K | |
| BCO 506 Nutrition and food Biochemistry.pdf | 2024-04-08 12:05 | 292K | |
| PCO-501 Solid State Chemistry I - Concepts and Applications.pdf | 2024-04-08 12:05 | 295K | |
| PCO-506 Nanoscience - Concepts and Applications.pdf | 2024-04-08 12:05 | 295K | |
| OCO-506 Introduction to Polymer Chemistry-I Basic Concepts.pdf | 2024-04-08 12:05 | 299K | |
| ICO-503 Chemistry of P-Block Elements.pdf | 2024-04-08 12:05 | 300K | |
| ICO-501 Bioinorganic Chemistry.pdf | 2024-04-08 12:05 | 304K | |
| ACO-503 Advanced Mass Spectrometry.pdf | 2024-04-08 12:05 | 314K | |
| OCO-504 Retrosynthesis in Organic Chemistry.pdf | 2024-04-08 12:05 | 314K | |
| CGO-500 Dissertation.pdf | 2024-04-08 12:05 | 317K | |
| ACO-505 Problems on Combined Spectroscopy.pdf | 2024-04-08 12:05 | 320K | |
| ACO-502 Calibrations and Validation in Analytical Chemistry.pdf | 2024-04-08 12:05 | 323K | |
| OCO-505 Heterocyclic Chemistry.pdf | 2024-04-08 12:05 | 329K | |
|
|---|