![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| PHSC-202 Band Theory and Electronic Properties of Solids.pdf | 2024-04-08 12:05 | 317K | |
| PHSC-201 Structure, Lattice and Thermal Properties of Solids.pdf | 2024-04-08 12:05 | 316K | |
| PHSO-214 Solid State Physics Practical.pdf | 2024-04-08 12:05 | 315K | |
| PHSC-203 Magnetic, Superconducting and Optical Properties of Solids.pdf | 2024-04-08 12:05 | 314K | |
| PHGO-212 Nuclear physics and Elementary Particle Physics.pdf | 2024-04-08 12:05 | 311K | |
| PHGO-213 Laser Physics and its applications.pdf | 2024-04-08 12:05 | 297K | |
| PHCC-221 Advanced Quantum Mechanics.pdf | 2024-04-08 12:05 | 292K | |
| PHCC-223 Numerical Techniques.pdf | 2024-04-08 12:05 | 287K | |
| PHCO-234 Numerical Techniques Practical.pdf | 2024-04-08 12:05 | 286K | |
| PHCC-222 Advanced Statistical Mechanics.pdf | 2024-04-08 12:05 | 286K | |