![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | MIC-526 Agriculture Microbiology [P].pdf | 2025-01-15 15:45 | 268K | |
| MIC-525 Agriculture Microbiology [T].pdf | 2025-01-15 15:45 | 276K | |
| MIC-515 Archaea � Ecology, Physiology, Biochemistry, and Genetics [P].pdf | 2025-01-15 15:45 | 272K | |
| MIC-514 Archaea � Ecology, Physiology, Biochemistry, and Genetics [T].pdf | 2025-01-15 15:45 | 271K | |
| MIC-513 Molecular Biology [P].pdf | 2025-01-15 15:45 | 270K | |
| MIC-512 Molecular Biology [T].pdf | 2025-01-15 15:45 | 278K | |
| MIC-510 Industrial Microbiology [T].pdf | 2025-01-15 15:45 | 272K | |
| MIC-509 Microbial Taxonomy and Systematics [P].pdf | 2025-01-15 15:45 | 280K | |
| MIC-508 Microbial Taxonomy and Systematics [T].pdf | 2025-01-15 15:45 | 277K | |
| MIC-500 Microbial Biochemistry [T](Repeat).pdf | 2025-01-15 15:45 | 232K | |
|
|---|