![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| ZOO-522 Advances in Genetics (Practical).pdf | 2025-01-15 15:45 | 226K | |
| ZOO-521 Advances in Genetics (Theory).pdf | 2025-01-15 15:45 | 226K | |
| ZOO-523 Animal Behaviour (Theory).pdf | 2025-01-15 15:45 | 227K | |
| ZOO-524 Animal Behaviour (Practical).pdf | 2025-01-15 15:45 | 227K | |
| ZOO-505 Field work-I.pdf | 2025-01-15 15:45 | 228K | |
| ZOO-504 Laboratory Course-I.pdf | 2025-01-15 15:45 | 228K | |
| ZOO-503 Molecular Biology.pdf | 2025-01-15 15:45 | 231K | |
| ZOO-500 Principles of Animal Systematics.pdf | 2025-01-15 15:45 | 235K | |
| ZOO-501 Anatomy of Non-Chordates.pdf | 2025-01-15 15:45 | 242K | |
| ZOO-502 Comparative Physiology of Animals.pdf | 2025-01-15 15:45 | 242K | |