![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| MBTC 405 Oceanography and Marine Bio resources.pdf | 2024-04-08 12:05 | 324K | |
| MBTC 408 Cell and Developmental Biology.pdf | 2024-04-08 12:05 | 320K | |
| MBTC 406 Aquaculture technology.pdf | 2024-04-08 12:05 | 318K | |
| MBPE 405 LAB VI Lab in Bioinformatics.pdf | 2024-04-08 12:05 | 314K | |
| MBTE 407 Genetics and Molecular Biology.pdf | 2024-04-08 12:05 | 313K | |
| MBTE 407 Vaccine technology.pdf | 2024-04-08 12:05 | 311K | |
| MBPC 407 LAB IV Genetics and Molecular Biology.pdf | 2024-04-08 12:05 | 306K | |
| MBPC 409 LAB V Plant and animal tissue culture.pdf | 2024-04-08 12:05 | 305K | |
| MBTE 409 Bioinformatics.pdf | 2024-04-08 12:05 | 303K | |