![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | 7.1.10.xlsx | 2025-03-27 16:55 | 10K | |
| joining Report.docx | 2025-03-27 13:00 | 13K | |
| joining report Varsha Naik (1).docx | 2025-03-27 13:00 | 13K | |
| joining report Varsha Naik.docx | 2025-03-27 13:00 | 13K | |
| Details of Documents.docx | 2025-03-27 16:55 | 22K | |
![[ ]](/icons/layout.gif) | 7.1.10-GrievanceCommitteeExams-2022.pdf | 2025-03-27 16:55 | 28K | |
| 7.1.3-SOE.pdf | 2025-03-27 13:00 | 32K | |
| 7.1.4-Statement-of-Expenditure-of-water-conservation-facilities.pdf | 2025-03-27 13:00 | 32K | |
| 7.1.8-PMSC202021.pdf | 2025-03-28 14:50 | 44K | |
| 7.1.8-PMSC202122.pdf | 2025-03-27 13:00 | 47K | |
| 7.1.1-Menstrual-Hygiene.pdf | 2025-03-26 10:35 | 49K | |
| 7.1.8-Thanksgiving2022.pdf | 2025-03-27 13:00 | 49K | |
| 7.1.8-Student-Aid-Fund-for-AY-202223.pdf | 2025-03-27 13:00 | 49K | |
| 7.1.8-Student-Aid-Fund-for-AY-202324.pdf | 2025-03-27 13:00 | 51K | |
| 7.1.8-Felicitation-&-Foundation-day-Circular-2023.pdf | 2025-03-27 13:00 | 61K | |
| 5.1.1-2.pdf | 2025-03-28 17:30 | 63K | |
| 7.1.8-PMSC202223.pdf | 2025-03-27 13:00 | 71K | |
| 7.2.1-seedMoneyRevisedCircular-Jan-2024.pdf | 2025-03-28 10:30 | 72K | |
| 7.2.1-Ghumat.pdf | 2025-03-28 10:30 | 76K | |
![[IMG]](/icons/image2.gif) | 7.1.8-Makar-Sankranti-2023.jpeg | 2025-03-27 13:00 | 76K | |
| 7.1.10-UnfairMeansCommittee-October2022.pdf | 2025-03-27 16:55 | 77K | |
| 7.1.8-Thanksgiving2019.pdf | 2025-03-27 13:00 | 79K | |
| 7.1.3-Supporting-Document2.pdf | 2025-04-01 11:30 | 82K | |
| 7.1.3-EE.jpg | 2025-03-27 13:00 | 82K | |
| 7.2.1-patentsFiledStatus.pdf | 2025-03-28 10:30 | 88K | |
| 7.1.10-UnfairMeansCommitteeOrder-March2023.pdf | 2025-03-27 16:55 | 89K | |
| 7.1.10-FIP-Non-Teaching-Programme-5-years-2019-20-to-2023-24.pdf | 2025-03-27 16:55 | 94K | |
| 7.1.8-CDFAA-1.jpg | 2025-03-28 16:40 | 96K | |
| 7.1.8-CDFAA.jpg | 2025-03-28 16:40 | 96K | |
| 7.1.18-CDFAA-1.jpg | 2025-03-28 17:05 | 96K | |
| 7.1.8-NAAC-Data-scholarships-and-freeships.pdf | 2025-03-28 14:50 | 97K | |
| 7.1.6-other-documents.pdf | 2025-03-28 16:40 | 100K | |
| 7.1.10-OrientationProgramme-2019.pdf | 2025-03-27 16:55 | 100K | |
| 7.1.8-Student-Aid-Fund-for-AY-202122.pdf | 2025-03-27 13:00 | 101K | |
| 7.1.7-Board-in-Braille-language-Faculty-BlockC.jpg | 2025-03-27 13:00 | 102K | |
| 7.1.1-Single-girl-child-scholarship.pdf | 2025-03-26 10:35 | 103K | |
| 7.1.10-Anti-ragging-meeting proceedings.jpeg | 2025-03-27 16:55 | 105K | |
| 7.1.7-Flyer-Sign-language-course.jpg | 2025-03-27 13:00 | 110K | |
| 7.1.8-Ghumat-Aarti-Competition.pdf | 2025-03-27 13:00 | 111K | |
| 7.1.7-Compliance-Report.pdf | 2025-03-27 13:00 | 111K | |
| 7.1.8-Dandiya-Night-Oct-2023.jpeg | 2025-03-27 13:00 | 112K | |
| 7.1.1-MEAR.pdf | 2022-12-24 12:00 | 113K | |
| 7.1.5-Internship-project-Greenery.pdf | 2025-03-27 13:00 | 116K | |
| 7.1.3-Supporting-Document1.pdf | 2025-03-28 14:25 | 120K | |
| 7.1.10-OBC-CellMeeting-2019-2024.pdf | 2025-03-27 16:55 | 124K | |
| 7.1.3-Supporting-Document3.pdf | 2025-03-28 14:25 | 124K | |
| 7.1.8-Plateaunica-March-2023.jpeg | 2025-03-27 13:00 | 125K | |
| 7.1.8-Thanksgiving2021.pdf | 2025-03-27 13:00 | 127K | |
| 7.1.9-circular-on-cleanliness-drive-on-campus-june-2019.jpg | 2025-03-28 10:45 | 128K | |
| 7.1.3-Wet-waste-dry-waste-segregation.jpeg | 2025-03-27 13:00 | 131K | |
| 7.1.3-Animal-house-incinerator02.jpg | 2025-03-27 13:00 | 137K | |
| 7.3.1-Meteorological-Tower.jpg | 2025-03-28 13:20 | 139K | |
| 7.1.8-Circular-Foundation-day-2020.pdf | 2025-03-28 14:50 | 142K | |
| 7.1.10-OrientationProgramme-2022.pdf | 2025-03-27 16:55 | 144K | |
| 7.1.8-Circular-foundation-day-2021.pdf | 2025-03-27 13:00 | 146K | |
| 7.1.10-OrientationProgramme-2024.pdf | 2025-03-27 16:55 | 149K | |
| 7.1.8-PMOBC202021.pdf | 2025-03-27 13:00 | 151K | |
| 7.1.8-Umang-Scholarship-for-AY-2023-24.pdf | 2025-03-27 13:00 | 154K | |
| 7.1.11-22-23-Word-Human-day.pdf | 2024-03-01 12:35 | 156K | |
| 7.1.10-OrientationProgramme-2023.pdf | 2025-03-27 16:55 | 156K | |
| 7.1.3-Disposal-Laboratory.pdf | 2025-03-27 13:00 | 157K | |
| 7.1.7-Wheelchair-Faculty-BlockC.jpg | 2025-03-27 13:00 | 157K | |
| 7.1.3-Anima-house01.jpg | 2025-03-27 13:00 | 159K | |
| 7.1.8-DHE202324.pdf | 2025-03-27 13:00 | 162K | |
| 7.1.8-Talaash-Report-2021.docx.pdf | 2025-03-28 14:50 | 165K | |
| 7.1.8-Talaash-Report-2021.pdf | 2025-03-28 15:30 | 165K | |
| 7.1.3-liquid-waste-treatment-plant.jpg | 2025-03-27 13:00 | 166K | |
| 7.1.10-ProceedingsofGrievances-2019-2024.pdf | 2025-03-27 16:55 | 174K | |
| 7.1.10-UnfairMeansCommitteeOrder-November2020.pdf | 2025-03-27 16:55 | 174K | |
| 7.1.8-DHE202122.pdf | 2025-03-27 13:00 | 179K | |
| 7.1.2-LED-materials-1.pdf | 2025-03-27 13:00 | 182K | |
| 7.1.4-bill-copy-of-rejuvenating-and-recommisioning-of-existing-rain-water-harvesting-system-near-electronics-(USIC)-building.pdf | 2022-12-24 17:00 | 192K | |
| 7.1.4-bill-copy-of-rejuvenating-and-recommissioning-of-existing-rain-water-harvesting-system-near-electronics-building.pdf | 2025-03-27 13:00 | 192K | |
| 7.1.5-Cleanliness-and-Other-Green-Drives.pdf | 2025-03-27 13:00 | 192K | |
| 7.1.2-Permission-to-grid-connectivity-2.pdf | 2025-03-27 13:00 | 195K | |
| 7.1.3-AnimalHouse-2.jpg | 2025-03-27 13:00 | 196K | |
| 7.1.4-bill-copy-of-recommissioning-of-the-existing-rain-water-harveting-system-near-silver-jubilee-hall.pdf | 2022-12-24 17:00 | 197K | |
| 7.1.8-DahiHandi2023.jpeg | 2025-03-27 13:00 | 200K | |
| ea1aa9d7-7cbe-438a-9b1a-791d954e727e.tmp | 2025-03-27 13:00 | 200K | |
| 7.1.2-Sensor-Based-Water-Pumps.pdf | 2025-03-27 13:00 | 205K | |
| 7.1.10-SC-STGrievanceCommittee-Meetings2019-2024.pdf | 2025-03-27 16:55 | 213K | |
| 7.1.2-Pictures-of-LED-Street-Lights-on-Campus.pdf | 2025-03-27 13:00 | 213K | |
| 7.1.8-Student-Aid-Fund-for-AY-202021.pdf | 2025-03-27 13:00 | 215K | |
| 7.1.3-APPROVAL-FROM-GSPCB.pdf | 2025-03-27 13:00 | 216K | |
| 7.1.3-plastic-collection-cage.jpg | 2025-03-27 13:00 | 219K | |
| 7.1.5-Letter-KTCL.pdf | 2025-03-27 13:00 | 224K | |
| 7.1.10-UnfairMeansCommitteeOrder-December2019.pdf | 2025-03-27 16:55 | 229K | |
| 7.1.8-Plateaunica-March-2024.jpeg | 2025-03-27 13:00 | 229K | |
| 7.1.8-Dandiya-Celebrations.pdf | 2025-03-27 13:00 | 229K | |
| 7.1.9-Purple-Campaign-GCQ.pdf | 2025-03-28 10:45 | 230K | |
| 7.1.8-Minorities201920.pdf | 2025-03-27 13:00 | 230K | |
| 7.1.8-Minorities202122.pdf | 2025-03-27 13:00 | 235K | |
| 7.1.8-Thanksgiving2023.pdf | 2025-03-27 13:00 | 253K | |
| 7.1.8-PMSC201920.pdf | 2025-03-27 13:00 | 253K | |
| 7.1.9-Official-Lang-Cell-2024-order.pdf | 2025-03-28 10:45 | 255K | |
| 7.1.8-Free-Studentship-for-AY-201920.pdf | 2025-03-27 13:00 | 257K | |
| 5.1.1-22-23_4_merged.pdf | 2025-03-28 17:30 | 260K | |
| 7.1.8-Student-Aid-Fund-for-AY-201920.pdf | 2025-03-27 13:00 | 262K | |
| 7.1.8-Christmas-December-2019.pdf | 2025-03-27 13:00 | 269K | |
| 7.1.8-DHE202021.pdf | 2025-03-27 13:00 | 272K | |
| 7.1.3-Invoice-Ponda-Envocare.pdf | 2025-03-27 13:00 | 273K | |
| 5.1.1-21-22_merged.pdf | 2025-03-28 17:30 | 275K | |
| 7.1.9-Purple-Campaign-Home-Science.pdf | 2025-03-28 10:45 | 276K | |
| 5.1.1-2020-21_1-(2)_merged.pdf | 2025-03-28 17:30 | 278K | |
| 7.1.8-PMOBC202122.pdf | 2025-03-27 13:00 | 281K | |
| 7.1.4-Water-sprinkler-system.jpg | 2025-03-27 13:00 | 284K | |
| 7.1.8-Minorities202021.pdf | 2025-03-27 13:00 | 302K | |
| 7.1.10-UMIC-Chairperson-November2021.pdf | 2025-03-27 16:55 | 303K | |
| 7.1.11-World-No-Tobacco-Day-Activity-Report.pdf | 2022-12-19 16:15 | 304K | |
| 7.1.8-Freestudentship-for-AY-202223.pdf | 2025-03-27 13:00 | 305K | |
| 7.1.1.Vendin-Machine-location.pdf | 2025-03-10 17:15 | 309K | |
| 7.1.9-Supporting-Document.pdf | 2025-03-29 10:30 | 310K | |
| 7.1.1-22-23-MEAR.pdf | 2024-02-29 15:15 | 316K | |
| 7.1.10-InternalCommittee-January2025.pdf | 2025-03-27 16:55 | 331K | |
| 7.1.2-LED-street-lights-2.pdf | 2025-03-27 13:00 | 331K | |
| 7.1.8-PMEBC202021.pdf | 2025-03-28 14:50 | 333K | |
| 7.1.7-A.C-Minutes-for-Sign-Language.pdf | 2025-03-27 13:00 | 338K | |
| 7.1.1-convocation-Medal-Awardees.pdf | 2025-03-26 10:35 | 343K | |
| 7.1.2-LED-materials-2.pdf | 2025-03-27 13:00 | 343K | |
| 7.1.10-UnfairMeansCommitteeMeetingProceedings-March2025.pdf | 2025-03-27 16:55 | 344K | |
| 7.1.8-DHE202223.pdf | 2025-03-27 13:00 | 352K | |
| 4.3.1-Dspace.pdf | 2025-03-27 13:00 | 354K | |
| 7.1.9-Goa-Liberation-Day-Circular-2019.pdf | 2025-03-28 10:45 | 361K | |
| 7.1.8-DahiHandiCelebrations-2019.pdf | 2025-03-27 13:00 | 361K | |
| 7.1.1-phd-Students.pdf | 2025-03-26 10:35 | 365K | |
| 7.1.9-23-24-Armed-Force-Flag-Day.pdf | 2025-03-10 17:15 | 369K | |
| 7.1.6-GREEN-ENERGYCerttificate-2025.pdf | 2025-03-28 10:25 | 372K | |
| 7.1.10-InductionofPartI-CSTStudents-2023.pdf | 2025-03-27 16:55 | 373K | |
| 7.1.8-Supporting-Document.pdf | 2025-04-01 15:10 | 373K | |
| 7.2.1-Best-Practice.pdf | 2025-03-28 11:05 | 374K | |
| 7.2.1 Best Practice.pdf | 2025-03-28 10:30 | 374K | |
| 7.1.9-Field-trip-Kajughoto-Quepem-part-of-Gender-and-Marginality-Coursework.pdf | 2025-03-28 10:45 | 377K | |
| 7.2.1-AwardsForMarineFarming.pdf | 2025-03-28 10:30 | 381K | |
| 7.1.8-Sahitya-Academy-Award.pdf | 2025-03-28 14:50 | 382K | |
| 7.1.11-22-23-Vigilance.pdf | 2024-03-01 14:10 | 382K | |
| 7.1.2-Sensor-Based-LEDs.pdf | 2025-03-27 13:00 | 382K | |
| 7.1.2-LED-materials-5.pdf | 2025-03-27 13:00 | 394K | |
| 7.1.9-Report-on-during-Vigilance-Awareness-Week-2022.pdf | 2025-03-28 10:45 | 398K | |
| 7.1.11-22-23-SPAS-Vigilance-Week-report.pdf | 2024-03-01 14:40 | 402K | |
| 7.1.7-Circular-International-Purple-Fest-Goa-2024.pdf | 2025-03-27 13:00 | 404K | |
| 7.1.1-MERU.pdf | 2025-03-26 10:35 | 405K | |
| 7.1.5-Detailed-Project-Report-of-MERU-project-under-PM-USHA-sanctioned-to-Goa-University.pdf | 2025-03-27 13:00 | 405K | |
| 7.1.9-Circular-Goa-Liberation-Day-2020.pdf | 2025-03-28 10:45 | 407K | |
| 7.1.8-circular-2022.pdf | 2025-03-27 13:00 | 417K | |
| 7.1.8-Natasha-Gomes-EFLTA-2021.pdf | 2025-03-28 14:50 | 420K | |
| 7.2.1-SeminarResourcePerson-MusselFarming.pdf | 2025-03-28 10:30 | 426K | |
| 7.1.2-LED-street-lights-1.pdf | 2025-03-27 13:00 | 428K | |
| 7.1.9-Samvidhan-diwas-constitutionday.pdf | 2025-03-28 10:45 | 432K | |
| 7.1.10-InductionProgrammeforPartI-CSTStudents-2024.pdf | 2025-03-27 16:55 | 433K | |
| 7.1.9-circular-on-cleanliness-drive-on-campus-2020-21.jpg | 2025-03-28 10:45 | 433K | |
| 7.1.8-Communal_Harmony-Week-2023-24.pdf | 2025-03-27 13:00 | 433K | |
| 7.1.10-InternalCommittee-September2020.pdf | 2025-03-27 16:55 | 434K | |
| 7.1.9-Visit-to-Goa-legislative-Assembly.pdf | 2025-03-28 10:45 | 440K | |
| 7.1.9-circular-on-cleanliness-drive-on-campus-2019-20.jpg | 2025-03-28 10:45 | 447K | |
| 7.1.9-23-24-Communal-Harmony.pdf | 2025-01-21 14:40 | 452K | |
| 7.1.10-UnfairMeansCommitteeConstitution-November2019.jpg | 2025-03-27 16:55 | 452K | |
| 7.1.8-Merit-Scholarship-for-AY-201920.pdf | 2025-03-27 13:00 | 458K | |
| 7.1.2-LED-street-lights-4.pdf | 2025-03-27 13:00 | 460K | |
| 7.1.11-22-23-Rashtriya-Ekta-Divas.pdf | 2024-03-01 14:10 | 475K | |
| 7.1.1-Gender-inequality.pdf | 2025-03-26 10:35 | 481K | |
| 7.1.3-napkin.pdf | 2025-03-27 13:00 | 483K | |
| 7.1.1-Student-Enrollment.pdf | 2025-03-26 10:35 | 493K | |
| 7.1.8-KalaSrujanotsav2024.pdf | 2025-03-27 13:00 | 507K | |
| 7.1.8-Dandiya-Night-2023.pdf | 2025-03-27 13:00 | 519K | |
| 7.1.3-Biodegradable-waste-composting.jpg | 2025-04-01 12:10 | 524K | |
| 7.1.2-LED-materials-4.pdf | 2025-03-27 13:00 | 546K | |
| 7.1.11-International-Day-Yoga.pdf | 2022-12-19 16:15 | 546K | |
| 7.2.1-OrderOfProject-March-2023.pdf | 2025-03-28 10:30 | 553K | |
| 7.1.4-Construction-of-Tanks-Bunds.pdf | 2025-04-22 15:50 | 558K | |
| 7.1.8-Free-Studentship-for-AY-202324.pdf | 2025-03-27 13:00 | 559K | |
| 7.2.1-OrdersIPRandPatentScheme-2022-23..pdf | 2025-03-28 10:30 | 568K | |
| 7.1.9-Report-Plastic-Collection-cum-Cleanliness-Drive-Report-World-Environment-Day-Celebration-2nd-June-2023-at-Faculty-BlockE.pdf | 2025-03-28 10:45 | 570K | |
| 7.3.1-Dr.-Arjun-Adhikari-Alumni.pdf | 2025-03-28 13:20 | 574K | |
| 7.1.2-Five-star-rated-fans-and-LED-materials.pdf | 2025-03-27 13:00 | 581K | |
| 7.2.1-OrdersIPRandPatentScheme-2021-22.pdf | 2025-03-28 10:30 | 581K | |
| 7.1.10-UnfairMeansCommittee-November2019.pdf | 2025-03-27 16:55 | 594K | |
| 7.2.1-SeedMoneyCircular-July-2020.pdf | 2025-03-28 10:30 | 595K | |
| 7.1.3-chemical-waste.jpeg | 2025-03-28 14:30 | 608K | |
| 7.1.3-chemical-waste.pdf | 2025-03-27 13:00 | 608K | |
| 7.1.4-Waste-water-Recycling.pdf | 2025-03-27 13:00 | 624K | |
| 7.1.1-Gender-Audit.pdf | 2025-03-26 10:35 | 629K | |
| 7.1.2-bill-Energy-Meters.pdf | 2025-03-27 13:00 | 630K | |
| 7.1.2-bill-of-energy-meters-wheeling-to-the-grid.pdf | 2025-03-27 13:00 | 630K | |
| 7.1.3-treatment-disposal.pdf | 2025-03-27 13:00 | 634K | |
| 7.1.9-Courses-on-campus-related-to-criteria.pdf | 2025-03-28 10:45 | 640K | |
| 7.2.1-IPROrders-2023-24.pdf | 2025-03-28 10:30 | 642K | |
| 7.1.8-DHE201920.pdf | 2025-03-27 13:00 | 650K | |
| 7.1.9-Session-addressing-sanitation-challenges-through-entrepreneurial-ecosystem-an-Indian-perspective.pdf | 2025-03-28 10:45 | 658K | |
| 7.1.9-Report-on-participation-in-Run-for-Unity.pdf | 2025-03-28 10:45 | 664K | |
| 7.1.3-sanitary-napkin-incinerator-2.jpg | 2025-03-27 13:00 | 672K | |
| 7.1.8-Free-Studentship-for-AY-202122.pdf | 2025-03-27 13:00 | 677K | |
| 7.1.3-Waste-collection.jpg | 2025-04-01 12:10 | 679K | |
| 7.1.8-DCT-Scholarships2023-24.pdf | 2025-03-27 13:00 | 683K | |
| 7.1.8-Free-Studentship-for-AY-202021.pdf | 2025-03-27 13:00 | 684K | |
| 7.1.8-DCT-Scholarships2021-22.pdf | 2025-03-27 13:00 | 684K | |
| 7.1.8-DCT-Scholarships2019-20.pdf | 2025-03-27 13:00 | 692K | |
| 7.1.8-DCT-Scholarships2022-23.pdf | 2025-03-27 13:00 | 695K | |
| 7.1.8-DCT-Scholarships 2020-21.pdf | 2025-03-27 13:00 | 698K | |
| 7.2.1-PatentGrantCertificate.pdf | 2025-03-28 10:30 | 701K | |
| 7.1.8-Earn while you learn 2021-22.pdf | 2025-03-27 13:00 | 724K | |
| 7.1.8-circular-foundation-day-2019.jpg | 2025-03-27 13:00 | 740K | |
| 7.1.9-Republic-Day-circular-2020.jpg | 2025-03-28 10:45 | 742K | |
| 7.1.2-LED-materials-3.pdf | 2025-03-27 13:00 | 762K | |
| 7.1.3-Compost-waste.jpg | 2025-04-01 12:10 | 777K | |
| 7.3.1-Trevor-Platt-Memorial-Award-Dr-Arjun-Adhikari.jpg | 2025-03-28 13:20 | 782K | |
| 7.1.1-22-23-Moral-Interrogations.pdf | 2024-02-29 15:15 | 783K | |
| 7.1.2-LED-street-lights-3.pdf | 2025-03-27 13:00 | 786K | |
| 7.1.8-Communal_Harmony-Week-2022-23.pdf | 2025-03-27 13:00 | 790K | |
| 7.1.8-ChristmasCelebration.pdf | 2025-03-27 13:00 | 794K | |
| 7.1.11-rakshabandhan-2022.pdf | 2025-03-27 13:05 | 809K | |
| 7.1.8-Report-on-TALAASH-2.0.pdf | 2025-03-27 13:00 | 811K | |
| 7.1.8-Merit-Scholarship-for-AY-202122.pdf | 2025-03-27 13:00 | 813K | |
| 7.1.10-PhotosofOrientationProgramme-2023.pdf | 2025-03-27 16:55 | 816K | |
| 7.1.5-Transport-facilities.pdf | 2025-03-27 13:00 | 821K | |
| 7.1.1-Menstrual-sanitary-pad-disposal-incinerator-in-ladies-washroom-at-F-Block.jpg | 2025-03-10 17:15 | 827K | |
| 7.1.3-PlasticBan.pdf | 2025-03-27 13:00 | 833K | |
| 7.1.5-Circular-on-ban-on-Plastic.pdf | 2025-03-27 13:00 | 833K | |
| 7.1.10-Workshop-on-Gender-Sensitization-2023.pdf | 2025-03-27 16:55 | 835K | |
| 7.1.9-National-Voters-Day-2022-celebrations-Discipline-of-French-and-Francophone-Studies.pdf | 2025-03-28 10:45 | 854K | |
| 7.1.8-Gomantakiya-mahitipat-mahotsav-2023.pdf | 2025-03-27 13:05 | 859K | |
| 7.1.5-Photos-of-Bins-on-Campus.pdf | 2025-04-01 12:15 | 885K | |
| 7.1.1-Menstrual-sanitary-pad-dispenser-and-incinerator-in-ladies-washroom-at-F-Block.jpg | 2025-03-10 17:15 | 904K | |
| 7.1.7-Disable-Friendly-Ramps-A-Block.jpg | 2025-03-27 13:00 | 911K | |
| 7.1.7-Disable-Friendly-Ramps-at-A-Block.jpg | 2025-03-10 17:15 | 911K | |
| 7.1.4-Borewell-Bills.pdf | 2025-03-27 13:00 | 913K | |
| 7.1.8-plateunica-2024.jpeg | 2025-03-27 13:00 | 915K | |
| 7.1.8-Report-rakshabandhan-2023.pdf | 2025-03-27 13:05 | 922K | |
| 7.1.1-CCTV-Cameras-at-B-Block.jpg | 2025-03-10 17:15 | 925K | |
| 7.1.9-Report-Azadi-Ka-Amrut-Mahotsav-MARATHI-Discipline.pdf | 2025-03-28 10:45 | 943K | |
| 7.1.1-Health-Centre.jpg | 2025-03-10 17:15 | 948K | |
| 7.1.8-Garba-Oct-22.pdf | 2025-03-27 13:00 | 949K | |
| 7.1.10-MeetingProceedings-InternalCommittee.pdf | 2025-03-27 16:55 | 960K | |
| 7.1.8-onam-2023.pdf | 2025-03-27 13:00 | 968K | |
| 7.1.8-Shardotsav_20Oct23.pdf | 2025-03-27 13:00 | 1.0M | |
| 7.1.8-Merit-Scholarship-for-AY-202223.pdf | 2025-03-27 13:00 | 1.0M | |
| 7.1.9-Report-of-Workshop-Legal-Awareness-Legal-Services-for-Empowerment-Tribals-and-TribalSubPlan.pdf | 2025-03-28 10:45 | 1.0M | |
| 7.1.10-PhotosofOrienationProgramme-2024.pdf | 2025-03-27 16:55 | 1.0M | |
| 7.1.1-Health-Centre-2.jpg | 2025-03-10 17:15 | 1.0M | |
| 7.1.7-Barrier-Free-Entry-at-HRDC.jpg | 2025-03-10 17:15 | 1.0M | |
| 7.1.8-Financial-Assistance-given-to-Cacra-Village-.pdf | 2025-03-27 13:00 | 1.0M | |
| 7.1.10-InternalCommitee-May2019.pdf | 2025-03-27 16:55 | 1.0M | |
| 7.1.7-Screen-reading-Facility-for-blind-students-at-Library.pdf | 2025-03-28 11:20 | 1.0M | |
| 7.1.1-CCTV-at-Women-s-Hostel.jpg | 2025-03-10 17:15 | 1.0M | |
| 7.1.1-Health-Centre-1.jpg | 2025-03-10 17:15 | 1.0M | |
| 7.1.7-Barrier-Free-Acess-at-HRDC--Entrance.jpg | 2025-03-10 17:15 | 1.0M | |
| 7.1.7-Barrier-Free-Acess-at-HRDC-Entrance.jpg | 2025-03-27 13:00 | 1.0M | |
| 7.1.7- audit-result.pdf | 2025-03-27 13:00 | 1.0M | |
| 7.1.8-PMOBC-SC202324.pdf | 2025-03-27 13:00 | 1.0M | |
| 7.1.3-Chemical-waste-collection-disposal.pdf | 2025-03-27 13:00 | 1.0M | |
| 7.1.1-Menstrual-sanitary-pad-dispenser-in-ladies-washroom-at-F-Block.jpg | 2025-03-10 17:15 | 1.0M | |
| 7.1.8-Certificate---JIPF-2023_Anthony-Gomes.pdf | 2025-03-27 13:00 | 1.0M | |
| 7.1.8-20190925.125331~Report_Ghumat_Arti.pdf | 2025-03-27 13:00 | 1.0M | |
| 7.1.8-KALA-SRUJONOTSAV-2022.pdf | 2025-03-27 13:00 | 1.0M | |
| 7.1.9-Epic-adhar-linking.pdf | 2025-03-28 10:45 | 1.0M | |
| 7.1.9-Poster-making-and-slogan-writing-on-road-safety.pdf | 2025-03-28 10:45 | 1.0M | |
| 7.1.7-Barrier-Free-Entry-at-HRDC-1.jpg | 2025-03-10 17:15 | 1.0M | |
| 7.1.9-Meri-Maati-Mera-Desh-report.pdf | 2025-03-28 10:45 | 1.0M | |
| 7.1.6-Agency-Report.pdf | 2025-03-28 10:25 | 1.0M | |
| 7.1.6-Certification.pdf | 2025-03-28 10:25 | 1.0M | |
| 7.1.7-Signages-for-lift-and-stairs-faculty-BlockE.jpg | 2025-03-27 13:00 | 1.1M | |
| 7.1.1-Security-Guard-at-F-Block-1.jpg | 2025-03-10 17:15 | 1.1M | |
| 7.1.8-KalaSrujonotsav2019.pdf | 2025-03-27 13:00 | 1.1M | |
| 7.1.7-Barrier-free-ramps-Examination-section-Confidential.jpg | 2025-03-27 13:00 | 1.1M | |
| 7.1.7-Barrier-free-ramps-at-Examination-section-Confidential.jpg | 2025-03-10 17:15 | 1.1M | |
| 7.1.8-Report-of-Plateaunica-2024.pdf | 2025-03-27 13:00 | 1.1M | |
| 7.1.1-Women-s-Hostel-I.jpg | 2025-03-10 17:15 | 1.1M | |
| 7.1.1-Security-Guard-at-Block-E.jpg | 2025-03-10 17:15 | 1.1M | |
| 7.1.1-Security-guard-at-F-Block-3.jpg | 2025-03-10 17:15 | 1.1M | |
| 7.1.7-disable-friendly-access-at-F-Block.jpg | 2025-03-10 17:15 | 1.1M | |
| 7.1.1-Decolinising-solidarit-and-Reciprocity.pdf | 2022-12-19 16:15 | 1.1M | |
| 7.1.1-Female-doctor-attending-patients.jpg | 2025-03-10 17:15 | 1.1M | |
| 7.1.4-Water-Distribution-Layout-in-Goa-University-Campus.pdf | 2025-03-28 11:20 | 1.1M | |
| 7.1.5-Battery-powered-vehicles.pdf | 2025-03-27 13:00 | 1.1M | |
| 7.1.7-Board-in-Braille-In-Faculty-Block-E.jpg | 2025-03-27 13:00 | 1.1M | |
| 7.1.1-Security-Guard-at-F-Block.jpg | 2025-03-10 17:15 | 1.1M | |
| 7.1.1-CCTV-at-Library.jpg | 2025-03-10 17:15 | 1.1M | |
| 7.1.1-Female-Security-Guard-at-Women-s-Hostel-I.jpg | 2025-03-10 17:15 | 1.1M | |
| 7.1.2-Solar-Energy-Meter-2.jpg | 2025-03-27 13:00 | 1.1M | |
| 7.1.9-Republic-Day-Circular-2023.pdf | 2025-03-28 10:45 | 1.1M | |
| 7.1.1-CCTV-at-Women-s-Hostel-1.jpg | 2025-03-10 17:15 | 1.1M | |
| 7.1.8-Konkani-short-film-Festival-2023.pdf | 2025-03-27 13:00 | 1.1M | |
| 7.1.1-Female-Security-Guard-at-Women-s-Hostel-II.jpg | 2025-03-10 17:15 | 1.1M | |
| 7.1.9-Republic-Day-2024.pdf | 2025-03-28 10:45 | 1.2M | |
| 7.1.1-Security-Guard-at-Block-E-4.jpg | 2025-03-10 17:15 | 1.2M | |
| 7.1.1-Women-s-Hostel-II.jpg | 2025-03-10 17:15 | 1.2M | |
| 7.1.1-Security-Guard-at-F-Block-2.jpg | 2025-03-10 17:15 | 1.2M | |
| 7.1.2-led-bill-1.pdf | 2025-03-27 13:00 | 1.2M | |
| 7.1.10-MinutesofMeetings-SCSTCell-2019-2024.pdf | 2025-03-27 16:55 | 1.2M | |
| 7.1.1-Women-s-Hostel.jpg | 2025-03-10 17:15 | 1.2M | |
| 7.1.2-bill-copy-of-on-campus-water-harvesting-JAL-SHAKTI-TEAM.pdf | 2022-12-24 16:40 | 1.2M | |
| 7.1.4-bill-copy-of-on-campus-water-harvesting-JAL-SHAKTI-TEAM.pdf | 2025-03-27 13:00 | 1.2M | |
| 7.1.9-Report-of-Elocution-Competition.pdf | 2025-03-28 10:45 | 1.2M | |
| 7.1.1-Security-Guard-at-HRDC.jpg | 2025-03-10 17:15 | 1.2M | |
| 7.1.5-Restricted-heavy-vehicles-sign-boards.pdf | 2025-03-27 13:00 | 1.2M | |
| 7.1.1-Security-Guard-at-Block-E-3.jpg | 2025-03-10 17:15 | 1.2M | |
| 7.1.9-Commemoration-of-Legal-Services-Day-and-Talk-on-Uniform-Civil-Code.pdf | 2025-03-28 10:45 | 1.2M | |
| 7.1.7-Barrier-Free-Access-at-Women-s-Hostel.jpg | 2025-03-10 17:15 | 1.2M | |
| 7.1.7-Barrier-Free-Access-at-Womens-Hostel.jpg | 2025-03-27 13:00 | 1.2M | |
| 7.1.9-Final-Report-on-Swachhata-Hi-Seva-2023-SCS-Campaign.pdf | 2025-03-28 10:45 | 1.2M | |
| 7.1.7-disable-friendly-access-F-Block-1.jpg | 2025-03-27 13:00 | 1.2M | |
| 7.1.7-disable-friendly-access-at-F-Block-1.jpg | 2025-03-10 17:15 | 1.2M | |
| 7.1.7-Machine-outside-Nanoscience-lab.jpg | 2025-03-27 13:00 | 1.2M | |
| 7.1.3-solid-waste-Segregation3.jpeg | 2025-03-27 13:00 | 1.2M | |
| 7.1.7-Floor-map-in-Faculty-Block-E.jpg | 2025-03-27 13:00 | 1.2M | |
| 7.1.1-Security-Guard-at-Men-s-Hostel.jpg | 2025-03-10 17:15 | 1.2M | |
| 7.1.9-lecture-series-under-Chhatrapati-Shivaji-Maharaj-Chair.pdf | 2025-03-28 10:45 | 1.2M | |
| 7.1.1-Security-Guard-at-Block-E-1.jpg | 2025-03-10 17:15 | 1.2M | |
| 7.1.8-Yuva-konkani-katha-sammelan-8Feb24.pdf | 2025-03-27 13:00 | 1.2M | |
| 7.1.10-PhotosofOrientationprogramme-2022.pdf | 2025-03-27 16:55 | 1.3M | |
| 7.1.9-One-day-seminar-on-advanced-public-administration-and-law.pdf | 2025-03-28 10:45 | 1.3M | |
| 7.1.5-EV-buses-on-Campus.pdf | 2025-03-27 13:00 | 1.3M | |
| 7.1.5-Landscaping-near-G-Block.jpg | 2025-03-10 17:15 | 1.3M | |
| 7.1.11-Francophonie-Celebrations-2022-Report.pdf | 2022-12-19 16:15 | 1.3M | |
| 7.1.7-Barrier-Free-Access-at-Health-Centre.jpg | 2025-03-27 13:00 | 1.3M | |
| 7.1.9-Corruption-free-India-for-developed-nation-under-Vigilance-awareness-week.pdf | 2025-03-28 10:45 | 1.3M | |
| 7.1.1-Parking-at-Women-s-Hostel.jpg | 2025-03-10 17:15 | 1.3M | |
| 7.1.9-Marathi-Department-Report-of-Shramdaan-Swachanjali-Cleanliness-Drive.pdf | 2025-03-28 10:45 | 1.3M | |
| 7.1.10-UnfairMeansCommitteeOrder-July2022.jpg | 2025-03-27 16:55 | 1.3M | |
| 7.1.1-Day-Care-Centre-Inside.jpg | 2025-03-10 17:15 | 1.3M | |
| 7.1.8-TALAASH--UNVEIL-YOUR-TALENT.pdf | 2025-03-27 13:00 | 1.3M | |
| 7.1.1-MG-quiz.pdf | 2022-12-19 16:15 | 1.3M | |
| 7.1.9-Circular-Goa-Liberation-Day-2022.pdf | 2025-03-28 10:45 | 1.3M | |
| 7.1.1-Security-Guard-at-Block-E-2.jpg | 2025-03-10 17:15 | 1.3M | |
| 7.1.9-Report-Special-Program-78th-Independence-Day-and-International-Youth-Day-Vikasit-Bharat-Ka-Mantra.pdf | 2025-03-28 10:45 | 1.3M | |
| 7.1.5-Parking-lot-at-A-block.jpg | 2025-03-10 17:15 | 1.4M | |
| 7.1.3-solid-waste-Segregation2.jpeg | 2025-03-27 13:00 | 1.4M | |
| 7.1.11-Glimpses-of-Gandhi-darshana.pdf | 2022-12-19 16:15 | 1.4M | |
| 7.2.1-VisitorsLog.pdf | 2025-03-28 10:30 | 1.4M | |
| 7.1.4-Rain-water-harvesting-1.jpg | 2025-03-10 17:15 | 1.4M | |
| 7.1.7-Disabled-Friendly-Washroom-faculty-block-F1.jpg | 2025-03-27 13:00 | 1.4M | |
| 7.1.9-Legal-awareness-programme.pdf | 2025-03-28 10:45 | 1.4M | |
| 7.1.9-Republic-Day-2022.pdf | 2025-03-28 10:45 | 1.4M | |
| 7.1.5-E-vehicles.jpg | 2025-03-10 17:15 | 1.4M | |
| 7.1.10-WORKSHOP-ON-SENSITIZATION-2022.jpg | 2025-03-27 16:55 | 1.4M | |
| 7.1.7-Disabled-Friendly-Parking-lots-at-men-s-hostel.jpg | 2025-03-10 17:15 | 1.4M | |
| 7.1.7-Disabled-Friendly-Parking-lots-mens-hostel.jpg | 2025-03-27 13:00 | 1.4M | |
| 7.1.5-Padestrian-Friendly-Pathways-Women-s-hostel-to-Admin-1.jpg | 2025-03-10 17:15 | 1.4M | |
| 7.1.5-Padestrian-Friendly-Pathway-From-A-Block-to-Admin-1.jpg | 2025-03-10 17:15 | 1.5M | |
| 7.1.4-Rain-water-harvesting.jpg | 2025-03-10 17:15 | 1.5M | |
| 7.1.9-lecture-series-under-Chhatrapati-Shivaji-Maharaj-Chair-at-St-Xaviers-college.pdf | 2025-03-28 10:45 | 1.5M | |
| 7.1.9-lecture-series-under-Chhatrapati-Shivaji-Maharaj-Chair-at-pes-college.pdf | 2025-03-28 10:45 | 1.5M | |
| 7.1.11-22-23-Millets.pdf | 2024-03-01 14:20 | 1.5M | |
| 7.1.2-Bil-Sensor-based-LED.pdf | 2025-03-27 13:00 | 1.5M | |
| 7.1.2-Bill-1.pdf | 2025-03-27 13:00 | 1.5M | |
| 7.1.8-DTW-AY-202122.pdf | 2025-03-27 13:00 | 1.5M | |
| 7.1.1-Day-Care-Centre.jpg | 2025-03-10 17:15 | 1.5M | |
| 7.1.5-Parking-at-B-Block.jpg | 2025-03-10 17:15 | 1.5M | |
| 7.1.1-22-23-Gender-Sensitisation.pdf | 2024-02-29 15:20 | 1.5M | |
| 7.1.7-Barrier-free-ramps-Examination-section-Confidential-2.jpg | 2025-03-27 13:00 | 1.5M | |
| 7.1.7-Barrier-free-ramps-at-Examination-section-Confidential-2.jpg | 2025-03-10 17:15 | 1.5M | |
| 7.1.9-Cleanliness-drive-on-04-10-2021.pdf | 2025-03-28 10:45 | 1.5M | |
| 7.1.2-Solar-Concentrator.pdf | 2022-12-24 16:40 | 1.5M | |
| 7.1.3-solid-waste-Segregation4.jpeg | 2025-03-27 13:00 | 1.5M | |
| 7.1.5-Padestrian-Friendly-Pathways-Admin-to-A-Block.jpg | 2025-03-10 17:15 | 1.5M | |
| 7.1.9-Street-Play-Road-Safety-with-GVM.pdf | 2025-03-28 10:45 | 1.6M | |
| 7.1.11-22-23-Constitution Day.pdf | 2024-03-01 14:20 | 1.6M | |
| 7.1.5-Padestrian-Friendly-pathways-from-Women-s-hostel-I-to-Hostel-II.jpg | 2025-03-10 17:15 | 1.6M | |
| 7.1.2-Solar-Panels-SCS.jpg | 2025-03-27 13:00 | 1.6M | |
| 7.1.6-TreePlantation-at-GU.pdf | 2025-03-28 10:25 | 1.6M | |
| 7.1.1-Science-tech-quiz.pdf | 2023-01-09 10:45 | 1.6M | |
| 7.1.1-Science_tech-quiz.pdf | 2022-12-19 16:15 | 1.6M | |
| 7.1.5-Padestrian-Friendly-Pathway-B-Block-to-A-Block.jpg | 2025-03-10 17:15 | 1.6M | |
| 7.1.8-Merit-Scholarship-for-AY-202021.pdf | 2025-03-27 13:00 | 1.6M | |
| 7.1.5-Landscaping-at-F-block.jpg | 2025-03-10 17:15 | 1.6M | |
| 7.1.5-Padestrian-Friendly-Pathways-Admin-to-A-Block-1.jpg | 2025-03-10 17:15 | 1.6M | |
| 7.1.5-E-vehicle.jpg | 2025-03-10 17:15 | 1.6M | |
| 7.1.5-Padestrian-Friendly-Pathways-Women-s-hostel-to-Admin.jpg | 2025-03-10 17:15 | 1.6M | |
| 7.1.1-Play-Area-near-Day-care-centre.jpg | 2025-03-10 17:15 | 1.6M | |
| 7.1.9-RASHTRIYA-EKTA-DIWAS-PLEDGE-REPORT-by-Discipline-of-French-and-Francophone-Studies.pdf | 2025-03-28 10:45 | 1.6M | |
| 7.1.1-Men-s-Hostel.jpg | 2025-03-10 17:15 | 1.6M | |
| 7.1.5-Padestrian-Friendly-Pathways-A-Block-to-B-Block.jpg | 2025-03-10 17:15 | 1.6M | |
| 7.1.5-Landscapping-with-trees-and-Plants.jpg | 2025-03-10 17:15 | 1.7M | |
| 7.1.3-Borewell-1.jpg | 2025-03-10 17:15 | 1.7M | |
| 7.1.3-Borewell.jpg | 2025-03-10 17:15 | 1.7M | |
| 7.1.8-DTW-AY-202021.pdf | 2025-03-27 13:00 | 1.7M | |
| 7.1.5-Padestrian-Friendly-Pathway-From-A-Block-to-Library.jpg | 2025-03-10 17:15 | 1.7M | |
| 7.1.1-Play-Area-near-Day-care-centre-1.jpg | 2025-03-10 17:15 | 1.7M | |
| 7.3.1-MoU-GU-IOW.pdf | 2025-03-28 13:20 | 1.7M | |
| 7.1.1-Common-room.pdf | 2025-03-26 10:35 | 1.7M | |
| 7.1.7-Lifts-for-easy-access-Block-F.jpg | 2025-03-27 13:00 | 1.7M | |
| 7.1.7-Lifts-for-easy-access-at-Block-F.jpg | 2025-03-10 17:15 | 1.7M | |
| 7.1.5-Padestrian-Friendly-Pathways-Admin-to-Directorate-Block.jpg | 2025-03-10 17:15 | 1.7M | |
| 7.1.7-Lifts-for-easy-access-at-F-Block.jpg | 2025-03-10 17:15 | 1.7M | |
| 7.1.5-E-vehicle-1.jpg | 2025-03-10 17:15 | 1.7M | |
| 7.1.11.pdf | 2023-02-09 16:25 | 1.7M | |
| 7.1.8-PMOBC202223.pdf | 2025-03-27 13:00 | 1.7M | |
| 7.1.5-Transport-Facilities.jpg | 2025-03-10 17:15 | 1.7M | |
| 7.1.5-Padestrian-Friendly-Pathways-Admin-to-Directorate-Block-1.jpg | 2025-03-10 17:15 | 1.7M | |
| 7.1.5-Car-Parking-at-B-Block.jpg | 2025-03-10 17:15 | 1.7M | |
| 7.1.3-solid-waste-Segregation1.jpeg | 2025-03-27 13:00 | 1.8M | |
| 7.1.1-Security-guard-at-Examination-section-confidential.jpg | 2025-03-10 17:15 | 1.8M | |
| 7.1.5-Horticulture-Activities-at-International-Guest-House-2.jpg | 2025-03-10 17:15 | 1.8M | |
| 7.1.5-Horticulture-Activities-at-International-Guest-House-1.jpg | 2025-03-10 17:15 | 1.8M | |
| 7.1.9-Report-of-Poster-Design-Slogan-Writing-competition.pdf | 2025-03-28 10:45 | 1.8M | |
| 7.1.7-Display-boards-for-directions.jpg | 2025-03-27 13:00 | 1.8M | |
| 7.1.9-Republic-Day-2021.pdf | 2025-03-28 10:45 | 1.8M | |
| 7.1.7-Ramp-MensHostel2.jpg | 2025-03-27 13:00 | 1.8M | |
| 7.1.5-Padestrian-Friendly-Pathway-From-B-Block-to-Canteen.jpg | 2025-03-10 17:15 | 1.8M | |
| 7.1.9-SCS-Plastic-clean-drive-Uste-Sattari.pdf | 2025-03-28 10:45 | 1.8M | |
| 7.1.7-Ramp-inside-IMBA-Dept.jpg | 2025-03-27 13:00 | 1.8M | |
| 7.1.1-22-23-purple-campaing.pdf | 2024-02-29 15:20 | 1.8M | |
| 7.1.9-A-Street-Play-On-Road-Safety-with-PES-College.pdf | 2025-03-28 15:30 | 1.9M | |
| 7.1.9-lecture-series-under-Chhatrapati-Shivaji-Maharaj-Chair-at-St-Xavier-College.pdf | 2025-03-28 10:45 | 1.9M | |
| 7.1.8-EBSB_Ranchi_Visit.pdf | 2025-03-27 13:00 | 1.9M | |
| 7.1.8-DTW-AY-201920.pdf | 2025-03-27 13:00 | 1.9M | |
| 7.2.1-PuranShetiNews.pdf | 2025-03-28 10:30 | 1.9M | |
| 7.1.9-Report-on-Special-Enrollment-Drive.pdf | 2025-03-28 10:45 | 1.9M | |
| 7.1.5-Horticulture-Activities-at-International-Guest-House.jpg | 2025-03-10 17:15 | 1.9M | |
| 7.1.9-Goa-liberation-Day-circular-2021.pdf | 2025-03-28 10:45 | 1.9M | |
| 7.1.9-Lecture-Simulating-Case-Studies-of-Constructivism-DemocraticPeace-and-Hegemonic-Stability-Theories-in-International-Relations.pdf | 2025-03-28 10:45 | 1.9M | |
| 7.1.2-Solar-Steam-Cooking.jpg | 2022-12-24 16:05 | 1.9M | |
| 7.1.9-Report-on-North-Goa-district-neighbourhood-youth-parliament-by-SIAS.pdf | 2025-03-28 10:45 | 1.9M | |
| 7.1.4-Rain-water-Harvesting-2.jpg | 2025-03-10 17:15 | 1.9M | |
| 7.1.9-Report-of-National-Voters-Day-Celebration.pdf | 2025-03-28 10:45 | 1.9M | |
| 7.1.7-Disabled-friendly-Ramp-from-Ground-to-Second-Floor-Eblock-2.jpg | 2025-03-27 13:00 | 1.9M | |
| 7.1.7-Ramp-Faculty-BlockC2.jpg | 2025-03-27 13:00 | 2.0M | |
| 7.1.8-Communal_Harmony-Week-2021-22.pdf | 2025-03-27 13:00 | 2.0M | |
| 7.1.9-Circular-Goa-Liberation-Day-2023.pdf | 2025-03-28 10:45 | 2.0M | |
| 7.1.9-Cleanliness-drive-at-shiroda-by-SPAS.pdf | 2025-03-28 10:45 | 2.0M | |
| 7.1.9-Purple-Campaign-Cuncolim.pdf | 2025-03-28 10:45 | 2.0M | |
| 7.1.7-Lift-at-Science-Block-E.jpg | 2025-03-27 13:00 | 2.0M | |
| 7.1.8-DTW-AY-202223.pdf | 2025-03-27 13:00 | 2.1M | |
| 7.1.2-Pictures-Use-of-LED-bulbsPower-efficient-Equipments.pdf | 2025-03-27 13:00 | 2.1M | |
| 7.1.2-Bill-3.pdf | 2025-03-27 13:00 | 2.1M | |
| 7.1.9-A-Street-Play-Road-Safety-with-Kala-Academi.pdf | 2025-03-28 10:45 | 2.1M | |
| 7.1.4-Rainwater-Harvesting-and-Groundwater-recharging-sites.pdf | 2025-03-27 13:00 | 2.1M | |
| 7.1.4-Rainwater-Harvesting.pdf | 2025-03-27 13:00 | 2.1M | |
| 7.1.8-Merit-Scholarship-AY-202324.pdf | 2025-03-27 13:00 | 2.1M | |
| 7.1.7-Disabled-Friendly-washrooms-at-F-Block.jpg | 2025-03-10 17:15 | 2.1M | |
| 7.1.7-Signage-for-disabled-friendly-washrooms-F-Block.jpg | 2025-03-27 13:00 | 2.1M | |
| 7.1.7-Signage-for-disabled-friendly-washrooms-at-F-Block.jpg | 2025-03-10 17:15 | 2.1M | |
| 7.1.7-Disable-friendly-access-at-Library.jpg | 2025-03-10 17:15 | 2.2M | |
| 7.1.5-EV-Vehicles-Bills.pdf | 2025-03-27 13:00 | 2.2M | |
| 7.2.1-MarineFarmingPudhariNews.docx.pdf | 2025-03-28 10:30 | 2.2M | |
| 7.1.11-22-23-Union-Budget.pdf | 2024-03-01 14:45 | 2.2M | |
| 7.1.8-Foundation-Day-Photos.pdf | 2025-03-28 14:50 | 2.2M | |
| 7.1.9-Cleanliness-drive-by-SPAS.pdf | 2025-03-28 10:45 | 2.2M | |
| 7.1.7-Disable-Friendly-access-Library-1.jpg | 2025-03-27 13:00 | 2.2M | |
| 7.1.7-Disable-Friendly-access-at-Library-1.jpg | 2025-03-10 17:15 | 2.2M | |
| 7.1.7-Disable-Friendly-access-at-A-Block.jpg | 2025-03-10 17:15 | 2.2M | |
| 7.1.9-Street-Play-Road-Safety-with-VD-&-SV-WAGLE-HIGH-SCHOOL.pdf | 2025-03-28 10:45 | 2.2M | |
| 7.1.1-WS-Syllabus.pdf | 2025-03-26 10:35 | 2.3M | |
| 7.1.7-Disabled-Friendly-Washroom-faculty-block-F2.jpg | 2025-03-27 13:00 | 2.3M | |
| 7.1.9-Workshop-on-Womens-Empowernment-and-Voting-Right.pdf | 2025-03-28 10:45 | 2.3M | |
| 7.1.9-Awareness-camp-on-welfare-schemes.pdf | 2025-03-28 10:45 | 2.3M | |
| 7.1.7-Ramp-International-Guest-House.jpg | 2025-03-27 13:00 | 2.3M | |
| 7.2.1-PhotosOfPuranSheti.pdf | 2025-03-28 10:30 | 2.3M | |
| 7.1.9-Electronics-Meri-maati-mera-desh-Aug-23.pdf | 2025-03-28 10:45 | 2.3M | |
| 7.1.2-Solar-Energy-Meter.jpg | 2025-03-27 13:00 | 2.3M | |
| 7.1.5-Landscaping-with-Trees-and-Plants.pdf | 2025-03-27 13:00 | 2.4M | |
| 7.1.7-Ramp-Faculty-canteen.jpg | 2025-03-27 13:00 | 2.4M | |
| 7.1.7-Tectile-Pathway-to-classrooms-Science-BlockE.jpg | 2025-03-27 13:00 | 2.4M | |
| 7.1.2-Solar-Energy-Meter-1.jpg | 2025-03-27 13:00 | 2.4M | |
| 7.1.1-Female-Security-Guard-at-Women-s-Hostel-III.jpg | 2025-03-10 17:15 | 2.4M | |
| 7.1.1-Female-Security-Guard-at-Women-s-Hostel-III-1.jpg | 2025-03-10 17:15 | 2.4M | |
| 7.2.1-MarineFarmingInVillage.pdf | 2025-03-28 10:30 | 2.4M | |
| 1.1.8-DTW AY 202324.pdf | 2025-03-27 13:00 | 2.4M | |
| 7.1.8-DTW-AY-202324.pdf | 2025-03-27 13:00 | 2.4M | |
| 7.1.3-solid-waste-Segregation.jpeg | 2025-03-27 13:00 | 2.4M | |
| 7.1.7-Ramp-Computer-Science-and-Technology-entrance.jpg | 2025-03-27 13:00 | 2.5M | |
| 7.1.9-Cleanliness-drive-Final-Report-30-Sept-2023.pdf | 2025-03-28 10:45 | 2.5M | |
| 7.1.1-Construction-Hostels-Men.pdf | 2025-03-26 10:35 | 2.5M | |
| 7.1.7-Disabled-friendly-Ramp-from-Ground-to-Second-Floor-Eblock-1.jpg | 2025-03-27 13:00 | 2.5M | |
| 7.1.3-E-Waste.pdf | 2025-03-27 13:00 | 2.6M | |
| 7.1.5-Padestrian-Friendly-Pathways-1.jpg | 2025-03-10 17:15 | 2.6M | |
| 7.1.5-Landscaping-with-plants-and-trees-at-Library.jpg | 2025-03-10 17:15 | 2.6M | |
| 7.1.7-Ramp-inside-Faculty-BlockB.jpg | 2025-03-27 13:00 | 2.6M | |
| 7.1.9-RASHTRIYA-EKTA-DIWAS-PLEDGE-by-Discipline-of-French-and-Francophone-Studies-(Oct2022).pdf | 2025-03-28 10:45 | 2.6M | |
| 7.1.8-Youthesia-2024.pdf | 2025-03-27 13:00 | 2.6M | |
| 7.1.2-Solar-Panels-GBS.jpg | 2025-03-27 13:00 | 2.6M | |
| 7.1.7-Signages-for-Lift-and-Ramp.jpg | 2025-03-27 13:00 | 2.6M | |
| 7.1.7-Ramp-entrance-CLAS.jpg | 2025-03-27 13:00 | 2.6M | |
| 7.1.7-Ramp-Entrance-Faculty-BlockB.jpg | 2025-03-27 13:00 | 2.7M | |
| 7.1.9-One-day-workshop-on-towards-access-to-justice.pdf | 2025-03-28 10:45 | 2.7M | |
| 7.1.10-Anti-Ragging-Workshop-Hostel-2024.pdf | 2025-03-27 16:55 | 2.7M | |
| 7.1.7-Tectile-pathway-to-labs-from-entrance-in-Science-blockE.jpg | 2025-03-27 13:00 | 2.7M | |
| 7.1.11-22-23-Kite-Function.pdf | 2024-03-01 14:20 | 2.8M | |
| 7.1.7-Barrier-free-ramps-at-Examination-section-Confidential-1.jpg | 2025-03-10 17:15 | 2.8M | |
| 7.1.9-International-Day-against-Drug-Abuse-and-Illicit-Tralficking.pdf | 2025-03-28 10:45 | 2.9M | |
| 7.1.7-Disable-Friendly-Access-A-Block-1.jpg | 2025-03-27 13:00 | 2.9M | |
| 7.1.7-Disable-Friendly-Access-at-A-Block-1.jpg | 2025-03-10 17:15 | 2.9M | |
| 7.1.5-Padestrian-Friendly-Pathway-From-A-Block-to-Admin.jpg | 2025-03-10 17:15 | 2.9M | |
| 7.1.1-Security-Guard-at-A-Block.jpg | 2025-03-10 17:15 | 2.9M | |
| 7.1.2-Work-Order-Solar-Rooftop.pdf | 2025-03-27 13:00 | 2.9M | |
| 7.1.2-Permission-grid-connectivity-Solar-energy.pdf | 2025-04-22 15:50 | 2.9M | |
| 7.1.2-Solar-Steam-Cooking.pdf | 2025-04-01 14:45 | 2.9M | |
| 7.1.10-Geotag-Photos.pdf | 2025-04-23 15:40 | 2.9M | |
| 7.1.5-Padestrian-Friendly-Pathways-2.jpg | 2025-03-10 17:15 | 2.9M | |
| 7.1.5-Padestrian-Friendly-Pathway-From-B-Block-to-A-Block.jpg | 2025-03-10 17:15 | 2.9M | |
| 7.1.7-Barrier-Free-Entry-at-B-Block.jpg | 2025-03-27 13:00 | 3.0M | |
| 7.1.8-PMOBC201920.pdf | 2025-03-27 13:00 | 3.0M | |
| 7.1.5-Padestrian-Friendly-Pathway-From-Canteen-to-B-Block-1.jpg | 2025-03-10 17:15 | 3.0M | |
| 7.1.5-Padestrian-Friendly-Pathways.jpg | 2025-03-10 17:15 | 3.0M | |
| 7.1.5-Padestrian-Friendly-Pathway-From-Admin-to-A-Block.jpg | 2025-03-10 17:15 | 3.0M | |
| 7.1.2-Windmill-School-of-Physical-and-Applied-Sciences.jpg | 2025-03-27 13:00 | 3.0M | |
| 7.1.4-Annual-Maintenance-Contract-for-Cleaning-of-Water-Storage-Tanks.pdf | 2025-03-27 13:00 | 3.0M | |
| 7.1.9-Independance-day-Circular.pdf | 2025-03-28 10:45 | 3.0M | |
| 7.1.5-Padestrian-Friendly-Pathway-From-Canteen-to-B-Block-2.jpg | 2025-03-10 17:15 | 3.0M | |
| 7.1.9-Slogan-writing-competition-and-screening-of-documentary-film-on-Gandhiji.pdf | 2025-03-28 10:45 | 3.1M | |
| 7.1.5-Padestrian-Friendly-Pathway-From-Canteen-to-B-Block.jpg | 2025-03-10 17:15 | 3.2M | |
| 7.1.2-Bill-2.pdf | 2025-03-27 13:00 | 3.2M | |
| 7.1.5-Padestrian-Friendly-Pathway-From-A-Block-to-B-Block.jpg | 2025-03-10 17:15 | 3.3M | |
| 7.1.7-MOU-With-Ali-Yavar-Jung-Institute.pdf | 2025-03-27 13:00 | 3.3M | |
| 7.1.7-Ramp-entrance-HRDC.jpg | 2025-03-27 13:00 | 3.3M | |
| 7.1.7-Disabled-friendly-pathway-Adminblock-Rightside-groundfloor.jpg | 2025-03-27 13:00 | 3.3M | |
| 7.1.1-women-empowerment.pdf | 2025-03-26 10:35 | 3.3M | |
| 7.1.9-Walkathon-SIAS.pdf | 2025-03-28 10:45 | 3.4M | |
| 7.1.9-Making-Equality-a-Reality-MEAR.pdf | 2025-03-28 10:45 | 3.4M | |
| 7.1.7-Ramp-MensHostel1.jpg | 2025-03-27 13:00 | 3.4M | |
| 7.1.2-use-of-LED-bulbs.pdf | 2022-12-24 16:40 | 3.5M | |
| 7.1.9-Report-on-Constitution-day-26-Nov-Marathi-Discipline.pdf | 2025-03-28 10:45 | 3.5M | |
| 7.1.9-seminar-on-Rights-of-elderly-citizens.pdf | 2025-03-28 10:45 | 3.5M | |
![[VID]](/icons/movie.gif) | 7.1.4-Recharging-of-IMBA-and-SPAS-borewell-by-rainwater-harvesting-project.mp4 | 2025-03-27 13:00 | 3.5M | |
| 7.1.9-MSW-Rural-Camp-MPS.pdf | 2025-03-28 10:45 | 3.6M | |
| 7.1.9-Cleanliness-drive-by-School-of-Chemical-Sciences-Goa-University-at-Khandepar-Junction-10th-March-2023.pdf | 2025-03-28 10:45 | 3.6M | |
| 7.1.7-Ramp-Goa-University-Gymnasia.jpg | 2025-03-27 13:00 | 3.6M | |
| 7.1.10-Report-on-Student-Attributes.pdf | 2025-04-23 15:40 | 3.6M | |
| 7.1.9-Report-of-OUTREACH-ACTIVITY-A-STREET-PLAY-ON-ROAD-SAFETY.pdf | 2025-03-28 10:45 | 3.7M | |
| 7.1.7-Ramp-Faculty-BlockC.jpg | 2025-03-27 13:00 | 3.9M | |
| 7.1.9-Awareness-on-swatchhta-road-safety-by-English-department.pdf | 2025-03-28 10:45 | 4.0M | |
| 7.1.4-Recharging-of-old-and-new-sports-borewellw-by-Bund-project-2.mp4 | 2025-03-27 13:00 | 4.0M | |
| 7.1.9-Sensitization-program-HIV-AIDS-by-MPS.pdf | 2025-03-28 10:45 | 4.0M | |
| 7.1.5-Pedestrian-Friendly-pathways.pdf | 2025-03-27 13:00 | 4.1M | |
| 7.1.2-solar-energy-and-wheeling-to-grid.pdf | 2022-12-24 16:40 | 4.1M | |
| 7.1.9-Report-Field-Trip-MPS.pdf | 2025-03-28 10:45 | 4.1M | |
| 7.1.6-Cleanliness-drive-Madkai-GudiParaoda-DonaPaula-Village.pdf | 2025-03-28 17:05 | 4.1M | |
| 7.1.6-Cleanliness-drive-Madkai-GudiParaoda-DonaPaula Village.pdf | 2025-04-01 12:20 | 4.1M | |
| 7.1.6-Cleanliness-drive-Madkai-GudiParaoda DonaPaula-Village.pdf | 2025-04-01 13:00 | 4.1M | |
| 7.1.7-Ramp-IMBA-Dept.jpg | 2025-03-27 13:00 | 4.2M | |
| 7.1.9-Hindi-Dept-cleanliness-drive-2022.pdf | 2025-03-28 10:45 | 4.2M | |
| 7.1.7-Disabled-friendly-pathway-Adminblock-Leftside-groundfloor.jpg | 2025-03-27 13:00 | 4.2M | |
| 7.2.1-SBSI-HANDBOOK.docx.pdf | 2025-03-28 10:30 | 4.2M | |
| 7.1.9-Report-on-workshop-on-Tanancy-Right.pdf | 2025-03-28 10:45 | 4.3M | |
| 7.1.4-Recycling-of-AC-wastewater-for-watering-plants-at-GBS-v1.mp4 | 2025-03-27 13:00 | 4.3M | |
| 7.1.9-SCS-Report-Week-Nonviolence-Peace-2021.pdf | 2025-03-28 10:45 | 4.3M | |
| 7.1.7-Disabled-friendly-ramp-Parking-basement-Science-BlockE.jpg | 2025-03-27 13:00 | 4.3M | |
| 7.1.8-TALAASH-2.0.pdf | 2025-03-27 13:00 | 4.5M | |
| 7.1.8-20240319.074028~TALAASH-3.pdf | 2025-03-27 13:00 | 4.6M | |
| 7.1.8-TALAASH-3.pdf | 2025-03-27 13:00 | 4.9M | |
| 7.1.6-Solar-ambassasdor.pdf | 2025-03-28 10:25 | 5.0M | |
| 7.1.1-nonviolence.pdf | 2022-12-19 16:15 | 5.2M | |
| 7.1.6-Green-audits.pdf | 2025-03-27 13:00 | 5.3M | |
| 7.1.6-Green audits 2020-21.pdf | 2025-03-28 10:25 | 5.4M | |
| 7.1.1-Gender-sensitization.pdf | 2025-03-26 10:35 | 5.6M | |
| 7.2.1-OysterFarming.doc.pdf | 2025-03-28 10:30 | 5.7M | |
| 7.1.4-Borewells-and-Water Sump.pdf | 2025-03-27 13:00 | 5.8M | |
| 7.2.1-Dr.IrineBook.pdf | 2025-03-28 10:30 | 5.9M | |
| 7.1.1-Counsellor.pdf | 2025-03-28 10:25 | 6.1M | |
| 7.1.1-Counsellor_merged_removed.pdf | 2025-03-28 11:20 | 6.1M | |
| 7.1.1-Photos.pdf | 2025-03-26 10:35 | 6.3M | |
| 7.1.3-Agreement-waste-management.pdf | 2025-03-27 13:00 | 6.6M | |
| 7.1.8-Marathi-Film-Festival-Activity-Report.pdf | 2025-03-27 13:00 | 6.7M | |
| 7.1.7-Screen-Reading-Facility.pdf | 2025-03-28 10:25 | 6.9M | |
| 7.1.5-Deccan-Tree-Plantation.pdf | 2025-03-28 10:25 | 6.9M | |
| Copy of ADMIN BLDG 5.JPG | 2025-03-27 13:00 | 6.9M | |
| GU-Photo2.jpg | 2025-03-27 13:00 | 7.0M | |
| 7.1.1-Surveillance.pdf | 2025-03-26 10:35 | 7.2M | |
| 7.1.4-Nestle-rainwater-harvesting-cum-ground-water-recharge-project-SCS.mp4 | 2025-03-27 13:00 | 8.2M | |
| 7.1.2-LED-bills.pdf | 2025-03-27 13:00 | 8.6M | |
| 7.1.11-International-Coastal-Cleanup.pdf | 2022-12-19 16:15 | 8.7M | |
| 7.1.6-Deccan-TreePlantation-Report.pdf | 2025-04-22 15:50 | 9.5M | |
| 7.1.6-Deccan-TreePlantation-at-GU.pdf | 2025-04-22 15:50 | 9.5M | |
| 7.1.6-Deccan-TreePlantation-at-GU_Upd.pdf | 2025-04-22 15:50 | 9.5M | |
| 7.1.9-Moot-court-report-2024.pdf | 2025-03-28 10:45 | 9.6M | |
| 7.2.1-PuranShetiReportI-April-2024.docx.pdf | 2025-03-28 10:30 | 12M | |
| 7.1.2-Solar-Steam-Cooking-1.pdf | 2025-03-27 13:00 | 12M | |
| 7.1.2-Wheeling-to-the-grid-details.pdf | 2025-03-27 13:00 | 14M | |
| 7.1.4-Bund-near-Goa-University-ground-v1.mp4 | 2025-03-27 13:00 | 14M | |
| 7.1.4-Bund-near-Goa-University-ground-v2.mp4 | 2025-03-27 13:00 | 14M | |
| 7.1.6-Green-Energy-&-Environment-Audit-GU-2025.pdf | 2025-03-28 10:25 | 18M | |
| 7.1.6-Green-Energy-&-Environment-Audit-GU-2025_Report with Certificate.pdf | 2025-03-28 11:20 | 18M | |
| free_cam_8_7_0.msi | 2025-03-27 13:00 | 22M | |
| 7.1.3-Sewage-Treatment-Plant-Video.mp4 | 2025-03-27 13:00 | 28M | |
| 7.1.5-Flora-Book.pdf | 2025-03-27 13:00 | 46M | |
|
|---|
